C20H38O12P2S4 — CID 159128366
diethyl 2-dimethoxyphosphinothioylsulfanylbutanedioate;diethyl 2-[methoxy(methylsulfanyl)phosphoryl]sulfanylbutanedioate (PubChem CID 159128366) has the molecular formula C20H38O12P2S4 and a molecular weight of 660.73 g/mol. Its IUPAC name is diethyl 2-dimethoxyphosphinothioylsulfanylbutanedioate;diethyl 2-[methoxy(methylsulfanyl)phosphoryl]sulfanylbutanedioate.
| Compound Name | diethyl 2-dimethoxyphosphinothioylsulfanylbutanedioate;diethyl 2-[methoxy(methylsulfanyl)phosphoryl]sulfanylbutanedioate |
|---|---|
| PubChem CID | 159128366 |
| Molecular Formula | C20H38O12P2S4 |
| Molecular Weight | 660.73 g/mol |
| Exact Mass | 660.07 |
| IUPAC Name | diethyl 2-dimethoxyphosphinothioylsulfanylbutanedioate;diethyl 2-[methoxy(methylsulfanyl)phosphoryl]sulfanylbutanedioate |
| SMILES | CCOC(=O)CC(SP(=O)(OC)SC)C(=O)OCC.CCOC(=O)CC(SP(=S)(OC)OC)C(=O)OCC |
| InChI | InChI=1S/2C10H19O6PS2/c1-5-15-9(11)7-8(10(12)16-6-2)19-17(13,14-3)18-4;1-5-15-9(11)7-8(10(12)16-6-2)19-17(18,13-3)14-4/h2*8H,5-7H2,1-4H3 |
| InChIKey | KGOIOAADRIHSRE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.73 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|