C38H52O18S4 — CID 70693283
diethyl 2-[2,4,5-tris[(1,4-diethoxy-1,4-dioxobutan-2-yl)sulfanyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]sulfanylbutanedioate (PubChem CID 70693283) has the molecular formula C38H52O18S4 and a molecular weight of 925.08 g/mol. Its IUPAC name is diethyl 2-[2,4,5-tris[(1,4-diethoxy-1,4-dioxobutan-2-yl)sulfanyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]sulfanylbutanedioate.
| Compound Name | diethyl 2-[2,4,5-tris[(1,4-diethoxy-1,4-dioxobutan-2-yl)sulfanyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]sulfanylbutanedioate |
|---|---|
| PubChem CID | 70693283 |
| Molecular Formula | C38H52O18S4 |
| Molecular Weight | 925.08 g/mol |
| Exact Mass | 924.20 |
| IUPAC Name | diethyl 2-[2,4,5-tris[(1,4-diethoxy-1,4-dioxobutan-2-yl)sulfanyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]sulfanylbutanedioate |
| SMILES | CCOC(=O)CC(SC1=C(SC(CC(=O)OCC)C(=O)OCC)C(=O)C(SC(CC(=O)OCC)C(=O)OCC)=C(SC(CC(=O)OCC)C(=O)OCC)C1=O)C(=O)OCC |
| InChI | InChI=1S/C38H52O18S4/c1-9-49-25(39)17-21(35(45)53-13-5)57-31-29(43)33(59-23(37(47)55-15-7)19-27(41)51-11-3)34(60-24(38(48)56-16-8)20-28(42)52-12-4)30(44)32(31)58-22(36(46)54-14-6)18-26(40)50-10-2/h21-24H,9-20H2,1-8H3 |
| InChIKey | YXPRQNLSWPEHSQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 244.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 925.08 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|