C10H20O7PS+ — CID 4712989
(1,4-diethoxy-1,4-dioxobutan-2-yl)sulfanyl-hydroxy-dimethoxyphosphanium (PubChem CID 4712989) has the molecular formula C10H20O7PS+ and a molecular weight of 315.30 g/mol. Its IUPAC name is (1,4-diethoxy-1,4-dioxobutan-2-yl)sulfanyl-hydroxy-dimethoxyphosphanium.
| Compound Name | (1,4-diethoxy-1,4-dioxobutan-2-yl)sulfanyl-hydroxy-dimethoxyphosphanium |
|---|---|
| PubChem CID | 4712989 |
| Molecular Formula | C10H20O7PS+ |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | (1,4-diethoxy-1,4-dioxobutan-2-yl)sulfanyl-hydroxy-dimethoxyphosphanium |
| SMILES | CCOC(=O)CC(S[P+](O)(OC)OC)C(=O)OCC |
| InChI | InChI=1S/C10H20O7PS/c1-5-16-9(11)7-8(10(12)17-6-2)19-18(13,14-3)15-4/h8,13H,5-7H2,1-4H3/q+1 |
| InChIKey | AXELDVQVHKCVKJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|