C22H22ClI3N2O9 — CID 87147237
[2,3-diacetyloxy-4-[3-carbonochloridoyl-N,2,4-triiodo-5-[methyl(prop-2-enyl)carbamoyl]anilino]-4-oxobutyl] acetate (PubChem CID 87147237) has the molecular formula C22H22ClI3N2O9 and a molecular weight of 874.59 g/mol. Its IUPAC name is [2,3-diacetyloxy-4-[3-carbonochloridoyl-N,2,4-triiodo-5-[methyl(prop-2-enyl)carbamoyl]anilino]-4-oxobutyl] acetate.
| Compound Name | [2,3-diacetyloxy-4-[3-carbonochloridoyl-N,2,4-triiodo-5-[methyl(prop-2-enyl)carbamoyl]anilino]-4-oxobutyl] acetate |
|---|---|
| PubChem CID | 87147237 |
| Molecular Formula | C22H22ClI3N2O9 |
| Molecular Weight | 874.59 g/mol |
| Exact Mass | 873.81 |
| IUPAC Name | [2,3-diacetyloxy-4-[3-carbonochloridoyl-N,2,4-triiodo-5-[methyl(prop-2-enyl)carbamoyl]anilino]-4-oxobutyl] acetate |
| SMILES | C=CCN(C)C(=O)c1cc(N(I)C(=O)C(OC(C)=O)C(COC(C)=O)OC(C)=O)c(I)c(C(=O)Cl)c1I |
| InChI | InChI=1S/C22H22ClI3N2O9/c1-6-7-27(5)21(33)13-8-14(18(25)16(17(13)24)20(23)32)28(26)22(34)19(37-12(4)31)15(36-11(3)30)9-35-10(2)29/h6,8,15,19H,1,7,9H2,2-5H3 |
| InChIKey | DPJALAAQMZQSLT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 136.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.59 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|