C18H20N4O3 — CID 87148315
2-N-hydroxy-6-N-(2-phenylethyl)-7,8-dihydro-5H-1,6-naphthyridine-2,6-dicarboxamide (PubChem CID 87148315) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is 2-N-hydroxy-6-N-(2-phenylethyl)-7,8-dihydro-5H-1,6-naphthyridine-2,6-dicarboxamide.
| Compound Name | 2-N-hydroxy-6-N-(2-phenylethyl)-7,8-dihydro-5H-1,6-naphthyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 87148315 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 2-N-hydroxy-6-N-(2-phenylethyl)-7,8-dihydro-5H-1,6-naphthyridine-2,6-dicarboxamide |
| SMILES | O=C(NO)c1ccc2c(n1)CCN(C(=O)NCCc1ccccc1)C2 |
| InChI | InChI=1S/C18H20N4O3/c23-17(21-25)16-7-6-14-12-22(11-9-15(14)20-16)18(24)19-10-8-13-4-2-1-3-5-13/h1-7,25H,8-12H2,(H,19,24)(H,21,23) |
| InChIKey | XLVIYJAINMGCQD-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|