C9H8BrF3 — CID 87148505
1-(bromomethyl)-4,5-dideuterio-2-methyl-3-(trifluoromethyl)benzene (PubChem CID 87148505) has the molecular formula C9H8BrF3 and a molecular weight of 255.07 g/mol. Its IUPAC name is 1-(bromomethyl)-4,5-dideuterio-2-methyl-3-(trifluoromethyl)benzene.
| Compound Name | 1-(bromomethyl)-4,5-dideuterio-2-methyl-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 87148505 |
| Molecular Formula | C9H8BrF3 |
| Molecular Weight | 255.07 g/mol |
| Exact Mass | 253.99 |
| IUPAC Name | 1-(bromomethyl)-4,5-dideuterio-2-methyl-3-(trifluoromethyl)benzene |
| SMILES | [2H]c1cc(CBr)c(C)c(C(F)(F)F)c1[2H] |
| InChI | InChI=1S/C9H8BrF3/c1-6-7(5-10)3-2-4-8(6)9(11,12)13/h2-4H,5H2,1H3/i2D,4D |
| InChIKey | YSABBOPLIUMXKY-XRIVEGAOSA-N |
| XLogP | 3.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.07 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|