C7H6BrF — CID 155765719
1-(bromomethyl)-3,5-dideuterio-2-fluorobenzene (PubChem CID 155765719) has the molecular formula C7H6BrF and a molecular weight of 191.04 g/mol. Its IUPAC name is 1-(bromomethyl)-3,5-dideuterio-2-fluorobenzene.
| Compound Name | 1-(bromomethyl)-3,5-dideuterio-2-fluorobenzene |
|---|---|
| PubChem CID | 155765719 |
| Molecular Formula | C7H6BrF |
| Molecular Weight | 191.04 g/mol |
| Exact Mass | 189.98 |
| IUPAC Name | 1-(bromomethyl)-3,5-dideuterio-2-fluorobenzene |
| SMILES | [2H]c1cc([2H])c(F)c(CBr)c1 |
| InChI | InChI=1S/C7H6BrF/c8-5-6-3-1-2-4-7(6)9/h1-4H,5H2/i1D,4D |
| InChIKey | FFWQLZFIMNTUCZ-DRSKVUCWSA-N |
| XLogP | 2.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.04 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|