About dihydroxy-prop-2-enoxy-sulfanylidene-λ5-phosphane;phenol
dihydroxy-prop-2-enoxy-sulfanylidene-λ5-phosphane;phenol (PubChem CID 87149561) has the molecular formula C9H13O4PS
and a molecular weight of 248.24 g/mol. Its IUPAC name is dihydroxy-prop-2-enoxy-sulfanylidene-λ5-phosphane;phenol.
Molecular Properties
| Compound Name | dihydroxy-prop-2-enoxy-sulfanylidene-λ5-phosphane;phenol |
| PubChem CID | 87149561 |
| Molecular Formula | C9H13O4PS |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | dihydroxy-prop-2-enoxy-sulfanylidene-λ5-phosphane;phenol |
| SMILES | C=CCOP(O)(O)=S.Oc1ccccc1 |
| InChI | InChI=1S/C6H6O.C3H7O3PS/c7-6-4-2-1-3-5-6;1-2-3-6-7(4,5)8/h1-5,7H;2H,1,3H2,(H2,4,5,8) |
| InChIKey | VZIQWVCKUPNNOG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy-prop-2-enoxy-sulfanylidene-λ5-phosphane;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy-prop-2-enoxy-sulfanylidene-λ5-phosphane;phenol?
The IUPAC name of dihydroxy-prop-2-enoxy-sulfanylidene-λ5-phosphane;phenol (CID 87149561) is dihydroxy-prop-2-enoxy-sulfanylidene-λ5-phosphane;phenol.
What is the SMILES notation for dihydroxy-prop-2-enoxy-sulfanylidene-λ5-phosphane;phenol?
The canonical SMILES for dihydroxy-prop-2-enoxy-sulfanylidene-λ5-phosphane;phenol is C=CCOP(O)(O)=S.Oc1ccccc1.
What is the InChIKey of dihydroxy-prop-2-enoxy-sulfanylidene-λ5-phosphane;phenol?
The InChIKey is VZIQWVCKUPNNOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O.C3H7O3PS/c7-6-4-2-1-3-5-6;1-2-3-6-7(4,5)8/h1-5,7H;2H,1,3H2,(H2,4,5,8).
What are the key properties of dihydroxy-prop-2-enoxy-sulfanylidene-λ5-phosphane;phenol?
dihydroxy-prop-2-enoxy-sulfanylidene-λ5-phosphane;phenol has a molecular weight of 248.24 g/mol, XLogP of 1.79, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy-prop-2-enoxy-sulfanylidene-λ5-phosphane;phenol is sourced from PubChem (CID 87149561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).