C23H26ClNO4 — CID 87150905
3-(3-chlorophenyl)-3-[2-hydroxy-4,6-dimethoxy-3-(piperidin-1-ylmethyl)phenyl]prop-1-en-1-one (PubChem CID 87150905) has the molecular formula C23H26ClNO4 and a molecular weight of 415.92 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-3-[2-hydroxy-4,6-dimethoxy-3-(piperidin-1-ylmethyl)phenyl]prop-1-en-1-one.
| Compound Name | 3-(3-chlorophenyl)-3-[2-hydroxy-4,6-dimethoxy-3-(piperidin-1-ylmethyl)phenyl]prop-1-en-1-one |
|---|---|
| PubChem CID | 87150905 |
| Molecular Formula | C23H26ClNO4 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 3-(3-chlorophenyl)-3-[2-hydroxy-4,6-dimethoxy-3-(piperidin-1-ylmethyl)phenyl]prop-1-en-1-one |
| SMILES | COc1cc(OC)c(C(C=C=O)c2cccc(Cl)c2)c(O)c1CN1CCCCC1 |
| InChI | InChI=1S/C23H26ClNO4/c1-28-20-14-21(29-2)22(18(9-12-26)16-7-6-8-17(24)13-16)23(27)19(20)15-25-10-4-3-5-11-25/h6-9,13-14,18,27H,3-5,10-11,15H2,1-2H3 |
| InChIKey | PRPAVWDMGPXEAD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|