C14H10F5O3P — CID 87155191
1-fluoro-4-[(4-fluorophenoxy)-(2,2,2-trifluoroethyl)phosphoryl]oxybenzene (PubChem CID 87155191) has the molecular formula C14H10F5O3P and a molecular weight of 352.20 g/mol. Its IUPAC name is 1-fluoro-4-[(4-fluorophenoxy)-(2,2,2-trifluoroethyl)phosphoryl]oxybenzene.
| Compound Name | 1-fluoro-4-[(4-fluorophenoxy)-(2,2,2-trifluoroethyl)phosphoryl]oxybenzene |
|---|---|
| PubChem CID | 87155191 |
| Molecular Formula | C14H10F5O3P |
| Molecular Weight | 352.20 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 1-fluoro-4-[(4-fluorophenoxy)-(2,2,2-trifluoroethyl)phosphoryl]oxybenzene |
| SMILES | O=P(CC(F)(F)F)(Oc1ccc(F)cc1)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C14H10F5O3P/c15-10-1-5-12(6-2-10)21-23(20,9-14(17,18)19)22-13-7-3-11(16)4-8-13/h1-8H,9H2 |
| InChIKey | WEACTWBYPKVHTJ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.20 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|