C18H17Cl3F3N3 — CID 87158597
[2-methyl-6-[3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]-3-pyridinyl]methanamine (PubChem CID 87158597) has the molecular formula C18H17Cl3F3N3 and a molecular weight of 438.71 g/mol. Its IUPAC name is [2-methyl-6-[3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]-3-pyridinyl]methanamine.
| Compound Name | [2-methyl-6-[3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 87158597 |
| Molecular Formula | C18H17Cl3F3N3 |
| Molecular Weight | 438.71 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | [2-methyl-6-[3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]-3-pyridinyl]methanamine |
| SMILES | Cc1nc(N2CCC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)ccc1CN |
| InChI | InChI=1S/C18H17Cl3F3N3/c1-10-11(8-25)2-3-15(26-10)27-5-4-17(9-27,18(22,23)24)12-6-13(19)16(21)14(20)7-12/h2-3,6-7H,4-5,8-9,25H2,1H3 |
| InChIKey | WZYGOFAUISYDFI-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.71 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|