C18H19ClO2 — CID 87166242
4-[4-(2-chloroethoxy)phenyl]-2-phenylbutanal (PubChem CID 87166242) has the molecular formula C18H19ClO2 and a molecular weight of 302.80 g/mol. Its IUPAC name is 4-[4-(2-chloroethoxy)phenyl]-2-phenylbutanal.
| Compound Name | 4-[4-(2-chloroethoxy)phenyl]-2-phenylbutanal |
|---|---|
| PubChem CID | 87166242 |
| Molecular Formula | C18H19ClO2 |
| Molecular Weight | 302.80 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 4-[4-(2-chloroethoxy)phenyl]-2-phenylbutanal |
| SMILES | O=CC(CCc1ccc(OCCCl)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H19ClO2/c19-12-13-21-18-10-7-15(8-11-18)6-9-17(14-20)16-4-2-1-3-5-16/h1-5,7-8,10-11,14,17H,6,9,12-13H2 |
| InChIKey | HNPCHMIXPACICZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.80 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|