C6H16O6P2S — CID 87173736
1-[hydroxy(propoxy)phosphinothioyl]oxypropylphosphonic acid (PubChem CID 87173736) has the molecular formula C6H16O6P2S and a molecular weight of 278.20 g/mol. Its IUPAC name is 1-[hydroxy(propoxy)phosphinothioyl]oxypropylphosphonic acid.
| Compound Name | 1-[hydroxy(propoxy)phosphinothioyl]oxypropylphosphonic acid |
|---|---|
| PubChem CID | 87173736 |
| Molecular Formula | C6H16O6P2S |
| Molecular Weight | 278.20 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | 1-[hydroxy(propoxy)phosphinothioyl]oxypropylphosphonic acid |
| SMILES | CCCOP(O)(=S)OC(CC)P(=O)(O)O |
| InChI | InChI=1S/C6H16O6P2S/c1-3-5-11-14(10,15)12-6(4-2)13(7,8)9/h6H,3-5H2,1-2H3,(H,10,15)(H2,7,8,9) |
| InChIKey | HDOYAMZNCJHPSL-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.20 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|