C11H22N2OS2 — CID 87177871
4-methyl-4-(methyldisulfanyl)-1-piperazin-1-ylpentan-1-one (PubChem CID 87177871) has the molecular formula C11H22N2OS2 and a molecular weight of 262.44 g/mol. Its IUPAC name is 4-methyl-4-(methyldisulfanyl)-1-piperazin-1-ylpentan-1-one.
| Compound Name | 4-methyl-4-(methyldisulfanyl)-1-piperazin-1-ylpentan-1-one |
|---|---|
| PubChem CID | 87177871 |
| Molecular Formula | C11H22N2OS2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 4-methyl-4-(methyldisulfanyl)-1-piperazin-1-ylpentan-1-one |
| SMILES | CSSC(C)(C)CCC(=O)N1CCNCC1 |
| InChI | InChI=1S/C11H22N2OS2/c1-11(2,16-15-3)5-4-10(14)13-8-6-12-7-9-13/h12H,4-9H2,1-3H3 |
| InChIKey | PZSDWEKDTOXAEG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|