C24H14N4O10S2 — CID 87179258
1-[2-[[2-(2,3-dinitrophenoxy)phenyl]disulfanyl]phenoxy]-2,3-dinitrobenzene (PubChem CID 87179258) has the molecular formula C24H14N4O10S2 and a molecular weight of 582.53 g/mol. Its IUPAC name is 1-[2-[[2-(2,3-dinitrophenoxy)phenyl]disulfanyl]phenoxy]-2,3-dinitrobenzene.
| Compound Name | 1-[2-[[2-(2,3-dinitrophenoxy)phenyl]disulfanyl]phenoxy]-2,3-dinitrobenzene |
|---|---|
| PubChem CID | 87179258 |
| Molecular Formula | C24H14N4O10S2 |
| Molecular Weight | 582.53 g/mol |
| Exact Mass | 582.02 |
| IUPAC Name | 1-[2-[[2-(2,3-dinitrophenoxy)phenyl]disulfanyl]phenoxy]-2,3-dinitrobenzene |
| SMILES | O=[N+]([O-])c1cccc(Oc2ccccc2SSc2ccccc2Oc2cccc([N+](=O)[O-])c2[N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C24H14N4O10S2/c29-25(30)15-7-5-11-19(23(15)27(33)34)37-17-9-1-3-13-21(17)39-40-22-14-4-2-10-18(22)38-20-12-6-8-16(26(31)32)24(20)28(35)36/h1-14H |
| InChIKey | GFYMSULJUCDRAH-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 191.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.53 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|