C14H10N4O10 — CID 154083486
1-[1-(2,3-dinitrophenoxy)ethoxy]-2,3-dinitrobenzene (PubChem CID 154083486) has the molecular formula C14H10N4O10 and a molecular weight of 394.25 g/mol. Its IUPAC name is 1-[1-(2,3-dinitrophenoxy)ethoxy]-2,3-dinitrobenzene.
| Compound Name | 1-[1-(2,3-dinitrophenoxy)ethoxy]-2,3-dinitrobenzene |
|---|---|
| PubChem CID | 154083486 |
| Molecular Formula | C14H10N4O10 |
| Molecular Weight | 394.25 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | 1-[1-(2,3-dinitrophenoxy)ethoxy]-2,3-dinitrobenzene |
| SMILES | CC(Oc1cccc([N+](=O)[O-])c1[N+](=O)[O-])Oc1cccc([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H10N4O10/c1-8(27-11-6-2-4-9(15(19)20)13(11)17(23)24)28-12-7-3-5-10(16(21)22)14(12)18(25)26/h2-8H,1H3 |
| InChIKey | CBSCOKJVHQZELD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 191.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.25 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|