C27H23F6N3O3 — CID 87179763
tert-butyl 2-[7-[5-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]-2,3-dihydro-1H-pyrrolo[1,2-a]indol-1-yl]acetate (PubChem CID 87179763) has the molecular formula C27H23F6N3O3 and a molecular weight of 551.49 g/mol. Its IUPAC name is tert-butyl 2-[7-[5-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]-2,3-dihydro-1H-pyrrolo[1,2-a]indol-1-yl]acetate.
| Compound Name | tert-butyl 2-[7-[5-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]-2,3-dihydro-1H-pyrrolo[1,2-a]indol-1-yl]acetate |
|---|---|
| PubChem CID | 87179763 |
| Molecular Formula | C27H23F6N3O3 |
| Molecular Weight | 551.49 g/mol |
| Exact Mass | 551.16 |
| IUPAC Name | tert-butyl 2-[7-[5-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]-2,3-dihydro-1H-pyrrolo[1,2-a]indol-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1CCc2cc3ccc(-c4noc(-c5cc(C(F)(F)F)cc(C(F)(F)F)c5)n4)cc3n21 |
| InChI | InChI=1S/C27H23F6N3O3/c1-25(2,3)38-22(37)13-20-7-6-19-10-14-4-5-15(11-21(14)36(19)20)23-34-24(39-35-23)16-8-17(26(28,29)30)12-18(9-16)27(31,32)33/h4-5,8-12,20H,6-7,13H2,1-3H3 |
| InChIKey | UCIDXKXUHXVPSW-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 70.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.49 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |