C27H24F3N3O6 — CID 161229606
tert-butyl 2-[(3R,4R)-4-hydroxy-7-[5-[3-phenyl-4-(trifluoromethyl)-1,2-oxazol-5-yl]-1,2,4-oxadiazol-3-yl]-3,4-dihydro-2H-chromen-3-yl]acetate (PubChem CID 161229606) has the molecular formula C27H24F3N3O6 and a molecular weight of 543.50 g/mol. Its IUPAC name is tert-butyl 2-[(3R,4R)-4-hydroxy-7-[5-[3-phenyl-4-(trifluoromethyl)-1,2-oxazol-5-yl]-1,2,4-oxadiazol-3-yl]-3,4-dihydro-2H-chromen-3-yl]acetate.
| Compound Name | tert-butyl 2-[(3R,4R)-4-hydroxy-7-[5-[3-phenyl-4-(trifluoromethyl)-1,2-oxazol-5-yl]-1,2,4-oxadiazol-3-yl]-3,4-dihydro-2H-chromen-3-yl]acetate |
|---|---|
| PubChem CID | 161229606 |
| Molecular Formula | C27H24F3N3O6 |
| Molecular Weight | 543.50 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | tert-butyl 2-[(3R,4R)-4-hydroxy-7-[5-[3-phenyl-4-(trifluoromethyl)-1,2-oxazol-5-yl]-1,2,4-oxadiazol-3-yl]-3,4-dihydro-2H-chromen-3-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@@H]1COc2cc(-c3noc(-c4onc(-c5ccccc5)c4C(F)(F)F)n3)ccc2[C@@H]1O |
| InChI | InChI=1S/C27H24F3N3O6/c1-26(2,3)37-19(34)12-16-13-36-18-11-15(9-10-17(18)22(16)35)24-31-25(39-33-24)23-20(27(28,29)30)21(32-38-23)14-7-5-4-6-8-14/h4-11,16,22,35H,12-13H2,1-3H3/t16-,22-/m1/s1 |
| InChIKey | NPUJZYMEKNTLGE-OPAMFIHVSA-N |
| XLogP | 5.85 |
| TPSA | 120.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.50 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |