C28H27F3N4O7 — CID 90465667
carbonic acid;(3S,4R)-3-(cyclopentylmethylamino)-7-[5-[3-phenyl-4-(trifluoromethyl)-1,2-oxazol-5-yl]-1,2,4-oxadiazol-3-yl]-3,4-dihydro-2H-chromen-4-ol (PubChem CID 90465667) has the molecular formula C28H27F3N4O7 and a molecular weight of 588.54 g/mol. Its IUPAC name is carbonic acid;(3S,4R)-3-(cyclopentylmethylamino)-7-[5-[3-phenyl-4-(trifluoromethyl)-1,2-oxazol-5-yl]-1,2,4-oxadiazol-3-yl]-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | carbonic acid;(3S,4R)-3-(cyclopentylmethylamino)-7-[5-[3-phenyl-4-(trifluoromethyl)-1,2-oxazol-5-yl]-1,2,4-oxadiazol-3-yl]-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 90465667 |
| Molecular Formula | C28H27F3N4O7 |
| Molecular Weight | 588.54 g/mol |
| Exact Mass | 588.18 |
| IUPAC Name | carbonic acid;(3S,4R)-3-(cyclopentylmethylamino)-7-[5-[3-phenyl-4-(trifluoromethyl)-1,2-oxazol-5-yl]-1,2,4-oxadiazol-3-yl]-3,4-dihydro-2H-chromen-4-ol |
| SMILES | O=C(O)O.O[C@@H]1c2ccc(-c3noc(-c4onc(-c5ccccc5)c4C(F)(F)F)n3)cc2OC[C@@H]1NCC1CCCC1 |
| InChI | InChI=1S/C27H25F3N4O4.CH2O3/c28-27(29,30)21-22(16-8-2-1-3-9-16)33-37-24(21)26-32-25(34-38-26)17-10-11-18-20(12-17)36-14-19(23(18)35)31-13-15-6-4-5-7-15;2-1(3)4/h1-3,8-12,15,19,23,31,35H,4-7,13-14H2;(H2,2,3,4)/t19-,23+;/m0./s1 |
| InChIKey | WGJSYWUXZQYSOY-ADMBKAPUSA-N |
| XLogP | 5.87 |
| TPSA | 163.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.54 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |