C27H25F3N4O6 — CID 123194456
ethyl 3-[[(3R,4S)-4-hydroxy-7-[5-[3-phenyl-4-(trifluoromethyl)-1,2-oxazol-5-yl]-1,2,4-oxadiazol-3-yl]-3,4-dihydro-2H-chromen-3-yl]amino]-2-methylpropanoate (PubChem CID 123194456) has the molecular formula C27H25F3N4O6 and a molecular weight of 558.51 g/mol. Its IUPAC name is ethyl 3-[[(3R,4S)-4-hydroxy-7-[5-[3-phenyl-4-(trifluoromethyl)-1,2-oxazol-5-yl]-1,2,4-oxadiazol-3-yl]-3,4-dihydro-2H-chromen-3-yl]amino]-2-methylpropanoate.
| Compound Name | ethyl 3-[[(3R,4S)-4-hydroxy-7-[5-[3-phenyl-4-(trifluoromethyl)-1,2-oxazol-5-yl]-1,2,4-oxadiazol-3-yl]-3,4-dihydro-2H-chromen-3-yl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 123194456 |
| Molecular Formula | C27H25F3N4O6 |
| Molecular Weight | 558.51 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | ethyl 3-[[(3R,4S)-4-hydroxy-7-[5-[3-phenyl-4-(trifluoromethyl)-1,2-oxazol-5-yl]-1,2,4-oxadiazol-3-yl]-3,4-dihydro-2H-chromen-3-yl]amino]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)CN[C@@H]1COc2cc(-c3noc(-c4onc(-c5ccccc5)c4C(F)(F)F)n3)ccc2[C@@H]1O |
| InChI | InChI=1S/C27H25F3N4O6/c1-3-37-26(36)14(2)12-31-18-13-38-19-11-16(9-10-17(19)22(18)35)24-32-25(40-34-24)23-20(27(28,29)30)21(33-39-23)15-7-5-4-6-8-15/h4-11,14,18,22,31,35H,3,12-13H2,1-2H3/t14?,18-,22+/m1/s1 |
| InChIKey | COUQJONLLBWSEJ-NKEUZDSBSA-N |
| XLogP | 4.66 |
| TPSA | 132.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |