C25H21F3N4O4 — CID 90465658
(3S,4S)-3-(cyclopropylmethylamino)-7-[5-[3-phenyl-4-(trifluoromethyl)-1,2-oxazol-5-yl]-1,2,4-oxadiazol-3-yl]-3,4-dihydro-2H-chromen-4-ol (PubChem CID 90465658) has the molecular formula C25H21F3N4O4 and a molecular weight of 498.46 g/mol. Its IUPAC name is (3S,4S)-3-(cyclopropylmethylamino)-7-[5-[3-phenyl-4-(trifluoromethyl)-1,2-oxazol-5-yl]-1,2,4-oxadiazol-3-yl]-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (3S,4S)-3-(cyclopropylmethylamino)-7-[5-[3-phenyl-4-(trifluoromethyl)-1,2-oxazol-5-yl]-1,2,4-oxadiazol-3-yl]-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 90465658 |
| Molecular Formula | C25H21F3N4O4 |
| Molecular Weight | 498.46 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | (3S,4S)-3-(cyclopropylmethylamino)-7-[5-[3-phenyl-4-(trifluoromethyl)-1,2-oxazol-5-yl]-1,2,4-oxadiazol-3-yl]-3,4-dihydro-2H-chromen-4-ol |
| SMILES | O[C@H]1c2ccc(-c3noc(-c4onc(-c5ccccc5)c4C(F)(F)F)n3)cc2OC[C@@H]1NCC1CC1 |
| InChI | InChI=1S/C25H21F3N4O4/c26-25(27,28)19-20(14-4-2-1-3-5-14)31-35-22(19)24-30-23(32-36-24)15-8-9-16-18(10-15)34-12-17(21(16)33)29-11-13-6-7-13/h1-5,8-10,13,17,21,29,33H,6-7,11-12H2/t17-,21-/m0/s1 |
| InChIKey | XIRMIJGOUIELOA-UWJYYQICSA-N |
| XLogP | 4.87 |
| TPSA | 106.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.46 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |