C26H23F3N4O7 — CID 90465649
carbonic acid;(3R,4S)-3-(cyclobutylamino)-7-[5-[3-phenyl-4-(trifluoromethyl)-1,2-oxazol-5-yl]-1,2,4-oxadiazol-3-yl]-3,4-dihydro-2H-chromen-4-ol (PubChem CID 90465649) has the molecular formula C26H23F3N4O7 and a molecular weight of 560.49 g/mol. Its IUPAC name is carbonic acid;(3R,4S)-3-(cyclobutylamino)-7-[5-[3-phenyl-4-(trifluoromethyl)-1,2-oxazol-5-yl]-1,2,4-oxadiazol-3-yl]-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | carbonic acid;(3R,4S)-3-(cyclobutylamino)-7-[5-[3-phenyl-4-(trifluoromethyl)-1,2-oxazol-5-yl]-1,2,4-oxadiazol-3-yl]-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 90465649 |
| Molecular Formula | C26H23F3N4O7 |
| Molecular Weight | 560.49 g/mol |
| Exact Mass | 560.15 |
| IUPAC Name | carbonic acid;(3R,4S)-3-(cyclobutylamino)-7-[5-[3-phenyl-4-(trifluoromethyl)-1,2-oxazol-5-yl]-1,2,4-oxadiazol-3-yl]-3,4-dihydro-2H-chromen-4-ol |
| SMILES | O=C(O)O.O[C@H]1c2ccc(-c3noc(-c4onc(-c5ccccc5)c4C(F)(F)F)n3)cc2OC[C@H]1NC1CCC1 |
| InChI | InChI=1S/C25H21F3N4O4.CH2O3/c26-25(27,28)19-20(13-5-2-1-3-6-13)31-35-22(19)24-30-23(32-36-24)14-9-10-16-18(11-14)34-12-17(21(16)33)29-15-7-4-8-15;2-1(3)4/h1-3,5-6,9-11,15,17,21,29,33H,4,7-8,12H2;(H2,2,3,4)/t17-,21+;/m1./s1 |
| InChIKey | UTNMGNHVHXEGHU-JKSHRDEXSA-N |
| XLogP | 5.24 |
| TPSA | 163.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.49 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |