C18H23NO6S — CID 87183765
4-(3,3-dimethylbut-1-ynyl)-3-[2-(2-methoxyethoxy)ethoxy]-N-sulfonylbenzamide (PubChem CID 87183765) has the molecular formula C18H23NO6S and a molecular weight of 381.45 g/mol. Its IUPAC name is 4-(3,3-dimethylbut-1-ynyl)-3-[2-(2-methoxyethoxy)ethoxy]-N-sulfonylbenzamide.
| Compound Name | 4-(3,3-dimethylbut-1-ynyl)-3-[2-(2-methoxyethoxy)ethoxy]-N-sulfonylbenzamide |
|---|---|
| PubChem CID | 87183765 |
| Molecular Formula | C18H23NO6S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 4-(3,3-dimethylbut-1-ynyl)-3-[2-(2-methoxyethoxy)ethoxy]-N-sulfonylbenzamide |
| SMILES | COCCOCCOc1cc(C(=O)N=S(=O)=O)ccc1C#CC(C)(C)C |
| InChI | InChI=1S/C18H23NO6S/c1-18(2,3)8-7-14-5-6-15(17(20)19-26(21)22)13-16(14)25-12-11-24-10-9-23-4/h5-6,13H,9-12H2,1-4H3 |
| InChIKey | HQNFYRGXVFCZMC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|