C25H31NO8S2 — CID 58119548
2-[2-[4-(3,3-dimethylbut-1-ynyl)-3-[2-(2-methoxyethoxy)ethoxy]phenyl]-2-oxoethyl]sulfonylbenzenesulfonamide (PubChem CID 58119548) has the molecular formula C25H31NO8S2 and a molecular weight of 537.66 g/mol. Its IUPAC name is 2-[2-[4-(3,3-dimethylbut-1-ynyl)-3-[2-(2-methoxyethoxy)ethoxy]phenyl]-2-oxoethyl]sulfonylbenzenesulfonamide.
| Compound Name | 2-[2-[4-(3,3-dimethylbut-1-ynyl)-3-[2-(2-methoxyethoxy)ethoxy]phenyl]-2-oxoethyl]sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 58119548 |
| Molecular Formula | C25H31NO8S2 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | 2-[2-[4-(3,3-dimethylbut-1-ynyl)-3-[2-(2-methoxyethoxy)ethoxy]phenyl]-2-oxoethyl]sulfonylbenzenesulfonamide |
| SMILES | COCCOCCOc1cc(C(=O)CS(=O)(=O)c2ccccc2S(N)(=O)=O)ccc1C#CC(C)(C)C |
| InChI | InChI=1S/C25H31NO8S2/c1-25(2,3)12-11-19-9-10-20(17-22(19)34-16-15-33-14-13-32-4)21(27)18-35(28,29)23-7-5-6-8-24(23)36(26,30)31/h5-10,17H,13-16,18H2,1-4H3,(H2,26,30,31) |
| InChIKey | AHQKEAAHVVSHLO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 139.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|