C19H25N5O4 — CID 87184922
[4-[4-(6-amino-5-formyl-3-pyridinyl)pyrazol-1-yl]piperidin-1-yl] tert-butyl carbonate (PubChem CID 87184922) has the molecular formula C19H25N5O4 and a molecular weight of 387.44 g/mol. Its IUPAC name is [4-[4-(6-amino-5-formyl-3-pyridinyl)pyrazol-1-yl]piperidin-1-yl] tert-butyl carbonate.
| Compound Name | [4-[4-(6-amino-5-formyl-3-pyridinyl)pyrazol-1-yl]piperidin-1-yl] tert-butyl carbonate |
|---|---|
| PubChem CID | 87184922 |
| Molecular Formula | C19H25N5O4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | [4-[4-(6-amino-5-formyl-3-pyridinyl)pyrazol-1-yl]piperidin-1-yl] tert-butyl carbonate |
| SMILES | CC(C)(C)OC(=O)ON1CCC(n2cc(-c3cnc(N)c(C=O)c3)cn2)CC1 |
| InChI | InChI=1S/C19H25N5O4/c1-19(2,3)27-18(26)28-23-6-4-16(5-7-23)24-11-15(10-22-24)13-8-14(12-25)17(20)21-9-13/h8-12,16H,4-7H2,1-3H3,(H2,20,21) |
| InChIKey | VIHUWWRCDPTVGQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|