C22H30N3O6+ — CID 87184961
(3S)-3-[[1-[(2S)-3-methyl-2-[(2-methylbenzoyl)amino]butanoyl]pyrrolidin-1-ium-1-carbonyl]amino]-4-oxobutanoic acid (PubChem CID 87184961) has the molecular formula C22H30N3O6+ and a molecular weight of 432.50 g/mol. Its IUPAC name is (3S)-3-[[1-[(2S)-3-methyl-2-[(2-methylbenzoyl)amino]butanoyl]pyrrolidin-1-ium-1-carbonyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[1-[(2S)-3-methyl-2-[(2-methylbenzoyl)amino]butanoyl]pyrrolidin-1-ium-1-carbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 87184961 |
| Molecular Formula | C22H30N3O6+ |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | (3S)-3-[[1-[(2S)-3-methyl-2-[(2-methylbenzoyl)amino]butanoyl]pyrrolidin-1-ium-1-carbonyl]amino]-4-oxobutanoic acid |
| SMILES | Cc1ccccc1C(=O)N[C@H](C(=O)[N+]1(C(=O)N[C@H](C=O)CC(=O)O)CCCC1)C(C)C |
| InChI | InChI=1S/C22H29N3O6/c1-14(2)19(24-20(29)17-9-5-4-8-15(17)3)21(30)25(10-6-7-11-25)22(31)23-16(13-26)12-18(27)28/h4-5,8-9,13-14,16,19H,6-7,10-12H2,1-3H3,(H2-,23,24,27,28,29,31)/p+1/t16-,19-/m0/s1 |
| InChIKey | NJVLOGFERRVPOQ-LPHOPBHVSA-O |
| XLogP | 1.64 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|