C23H27N3O6 — CID 59044000
(3S)-3-[[(2S)-2-[[(2S)-3-methyl-2-(naphthalene-1-carbonylamino)butanoyl]amino]propanoyl]amino]-4-oxobutanoic acid (PubChem CID 59044000) has the molecular formula C23H27N3O6 and a molecular weight of 441.48 g/mol. Its IUPAC name is (3S)-3-[[(2S)-2-[[(2S)-3-methyl-2-(naphthalene-1-carbonylamino)butanoyl]amino]propanoyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[(2S)-2-[[(2S)-3-methyl-2-(naphthalene-1-carbonylamino)butanoyl]amino]propanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 59044000 |
| Molecular Formula | C23H27N3O6 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | (3S)-3-[[(2S)-2-[[(2S)-3-methyl-2-(naphthalene-1-carbonylamino)butanoyl]amino]propanoyl]amino]-4-oxobutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)c1cccc2ccccc12)C(=O)N[C@@H](C)C(=O)N[C@H](C=O)CC(=O)O |
| InChI | InChI=1S/C23H27N3O6/c1-13(2)20(23(32)24-14(3)21(30)25-16(12-27)11-19(28)29)26-22(31)18-10-6-8-15-7-4-5-9-17(15)18/h4-10,12-14,16,20H,11H2,1-3H3,(H,24,32)(H,25,30)(H,26,31)(H,28,29)/t14-,16-,20-/m0/s1 |
| InChIKey | FNJCZYDZBGYRFX-UVFQYZLESA-N |
| XLogP | 1.26 |
| TPSA | 141.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|