C24H28N2O6 — CID 139786800
(3S)-3-[[(2S,5S)-2,6-dimethyl-5-(naphthalene-2-carbonylamino)-4-oxoheptanoyl]amino]-4-oxobutanoic acid (PubChem CID 139786800) has the molecular formula C24H28N2O6 and a molecular weight of 440.50 g/mol. Its IUPAC name is (3S)-3-[[(2S,5S)-2,6-dimethyl-5-(naphthalene-2-carbonylamino)-4-oxoheptanoyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[(2S,5S)-2,6-dimethyl-5-(naphthalene-2-carbonylamino)-4-oxoheptanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 139786800 |
| Molecular Formula | C24H28N2O6 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | (3S)-3-[[(2S,5S)-2,6-dimethyl-5-(naphthalene-2-carbonylamino)-4-oxoheptanoyl]amino]-4-oxobutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)c1ccc2ccccc2c1)C(=O)C[C@H](C)C(=O)N[C@H](C=O)CC(=O)O |
| InChI | InChI=1S/C24H28N2O6/c1-14(2)22(20(28)10-15(3)23(31)25-19(13-27)12-21(29)30)26-24(32)18-9-8-16-6-4-5-7-17(16)11-18/h4-9,11,13-15,19,22H,10,12H2,1-3H3,(H,25,31)(H,26,32)(H,29,30)/t15-,19-,22-/m0/s1 |
| InChIKey | HIXUDGYLBZFUKJ-OHEPNIRZSA-N |
| XLogP | 2.35 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|