C16H31N3O4S — CID 87186011
tert-butyl (6S)-6,7-diamino-6-[(2-methylpropan-2-yl)oxycarbonylamino]-7-sulfanylideneheptanoate (PubChem CID 87186011) has the molecular formula C16H31N3O4S and a molecular weight of 361.51 g/mol. Its IUPAC name is tert-butyl (6S)-6,7-diamino-6-[(2-methylpropan-2-yl)oxycarbonylamino]-7-sulfanylideneheptanoate.
| Compound Name | tert-butyl (6S)-6,7-diamino-6-[(2-methylpropan-2-yl)oxycarbonylamino]-7-sulfanylideneheptanoate |
|---|---|
| PubChem CID | 87186011 |
| Molecular Formula | C16H31N3O4S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | tert-butyl (6S)-6,7-diamino-6-[(2-methylpropan-2-yl)oxycarbonylamino]-7-sulfanylideneheptanoate |
| SMILES | CC(C)(C)OC(=O)CCCC[C@](N)(NC(=O)OC(C)(C)C)C(N)=S |
| InChI | InChI=1S/C16H31N3O4S/c1-14(2,3)22-11(20)9-7-8-10-16(18,12(17)24)19-13(21)23-15(4,5)6/h7-10,18H2,1-6H3,(H2,17,24)(H,19,21)/t16-/m0/s1 |
| InChIKey | ZDUCDLKCNZVAIB-INIZCTEOSA-N |
| XLogP | 2.35 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|