About 1-isothiocyanatoethyl acetate
1-isothiocyanatoethyl acetate (PubChem CID 87196240) has the molecular formula C5H7NO2S
and a molecular weight of 145.18 g/mol. Its IUPAC name is 1-isothiocyanatoethyl acetate.
Molecular Properties
| Compound Name | 1-isothiocyanatoethyl acetate |
| PubChem CID | 87196240 |
| Molecular Formula | C5H7NO2S |
| Molecular Weight | 145.18 g/mol |
| Exact Mass | 145.02 |
| IUPAC Name | 1-isothiocyanatoethyl acetate |
| SMILES | CC(=O)OC(C)N=C=S |
| InChI | InChI=1S/C5H7NO2S/c1-4(6-3-9)8-5(2)7/h4H,1-2H3 |
| InChIKey | DTQBWTUWLLDKOA-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.18 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-isothiocyanatoethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-isothiocyanatoethyl acetate?
The IUPAC name of 1-isothiocyanatoethyl acetate (CID 87196240) is 1-isothiocyanatoethyl acetate.
What is the SMILES notation for 1-isothiocyanatoethyl acetate?
The canonical SMILES for 1-isothiocyanatoethyl acetate is CC(=O)OC(C)N=C=S.
What is the InChIKey of 1-isothiocyanatoethyl acetate?
The InChIKey is DTQBWTUWLLDKOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO2S/c1-4(6-3-9)8-5(2)7/h4H,1-2H3.
What are the key properties of 1-isothiocyanatoethyl acetate?
1-isothiocyanatoethyl acetate has a molecular weight of 145.18 g/mol, XLogP of 1.00, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-isothiocyanatoethyl acetate is sourced from PubChem (CID 87196240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).