About 3-isocyanatobutan-2-yl acetate
3-isocyanatobutan-2-yl acetate (PubChem CID 90360581) has the molecular formula C7H11NO3
and a molecular weight of 157.17 g/mol. Its IUPAC name is 3-isocyanatobutan-2-yl acetate.
Molecular Properties
| Compound Name | 3-isocyanatobutan-2-yl acetate |
| PubChem CID | 90360581 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 3-isocyanatobutan-2-yl acetate |
| SMILES | CC(=O)OC(C)C(C)N=C=O |
| InChI | InChI=1S/C7H11NO3/c1-5(8-4-9)6(2)11-7(3)10/h5-6H,1-3H3 |
| InChIKey | RHLBAWWHNKFNRU-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 3-isocyanatobutan-2-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-isocyanatobutan-2-yl acetate?
The IUPAC name of 3-isocyanatobutan-2-yl acetate (CID 90360581) is 3-isocyanatobutan-2-yl acetate.
What is the SMILES notation for 3-isocyanatobutan-2-yl acetate?
The canonical SMILES for 3-isocyanatobutan-2-yl acetate is CC(=O)OC(C)C(C)N=C=O.
What is the InChIKey of 3-isocyanatobutan-2-yl acetate?
The InChIKey is RHLBAWWHNKFNRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3/c1-5(8-4-9)6(2)11-7(3)10/h5-6H,1-3H3.
What are the key properties of 3-isocyanatobutan-2-yl acetate?
3-isocyanatobutan-2-yl acetate has a molecular weight of 157.17 g/mol, XLogP of 0.66, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-isocyanatobutan-2-yl acetate is sourced from PubChem (CID 90360581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).