C15H15F3N2O2 — CID 87196886
2-[2-cyano-5-(trifluoromethyl)phenyl]-2-piperidin-4-ylacetic acid (PubChem CID 87196886) has the molecular formula C15H15F3N2O2 and a molecular weight of 312.29 g/mol. Its IUPAC name is 2-[2-cyano-5-(trifluoromethyl)phenyl]-2-piperidin-4-ylacetic acid.
| Compound Name | 2-[2-cyano-5-(trifluoromethyl)phenyl]-2-piperidin-4-ylacetic acid |
|---|---|
| PubChem CID | 87196886 |
| Molecular Formula | C15H15F3N2O2 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 2-[2-cyano-5-(trifluoromethyl)phenyl]-2-piperidin-4-ylacetic acid |
| SMILES | N#Cc1ccc(C(F)(F)F)cc1C(C(=O)O)C1CCNCC1 |
| InChI | InChI=1S/C15H15F3N2O2/c16-15(17,18)11-2-1-10(8-19)12(7-11)13(14(21)22)9-3-5-20-6-4-9/h1-2,7,9,13,20H,3-6H2,(H,21,22) |
| InChIKey | OPBGZWCLRWWFCI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |