C11H9BrF3NO2 — CID 171860892
2-(3-bromo-1,2-dihydroxypropyl)-4-(trifluoromethyl)benzonitrile (PubChem CID 171860892) has the molecular formula C11H9BrF3NO2 and a molecular weight of 324.10 g/mol. Its IUPAC name is 2-(3-bromo-1,2-dihydroxypropyl)-4-(trifluoromethyl)benzonitrile.
| Compound Name | 2-(3-bromo-1,2-dihydroxypropyl)-4-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 171860892 |
| Molecular Formula | C11H9BrF3NO2 |
| Molecular Weight | 324.10 g/mol |
| Exact Mass | 322.98 |
| IUPAC Name | 2-(3-bromo-1,2-dihydroxypropyl)-4-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(C(F)(F)F)cc1C(O)C(O)CBr |
| InChI | InChI=1S/C11H9BrF3NO2/c12-4-9(17)10(18)8-3-7(11(13,14)15)2-1-6(8)5-16/h1-3,9-10,17-18H,4H2 |
| InChIKey | JDVDRNJASRWELA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.10 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|