C5H2Cl4O5 — CID 87197382
(2,2-dichloroacetyl)oxycarbonyl 2,2-dichloroacetate (PubChem CID 87197382) has the molecular formula C5H2Cl4O5 and a molecular weight of 283.88 g/mol. Its IUPAC name is (2,2-dichloroacetyl)oxycarbonyl 2,2-dichloroacetate.
| Compound Name | (2,2-dichloroacetyl)oxycarbonyl 2,2-dichloroacetate |
|---|---|
| PubChem CID | 87197382 |
| Molecular Formula | C5H2Cl4O5 |
| Molecular Weight | 283.88 g/mol |
| Exact Mass | 281.87 |
| IUPAC Name | (2,2-dichloroacetyl)oxycarbonyl 2,2-dichloroacetate |
| SMILES | O=C(OC(=O)C(Cl)Cl)OC(=O)C(Cl)Cl |
| InChI | InChI=1S/C5H2Cl4O5/c6-1(7)3(10)13-5(12)14-4(11)2(8)9/h1-2H |
| InChIKey | VQUAMWXPNUWSSG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.88 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|