About chloro 2,2-dichloroacetate;hydride;rubidium(1+)
chloro 2,2-dichloroacetate;hydride;rubidium(1+) (PubChem CID 173369816) has the molecular formula C2H2Cl3O2Rb
and a molecular weight of 249.86 g/mol. Its IUPAC name is chloro 2,2-dichloroacetate;hydride;rubidium(1+).
Molecular Properties
| Compound Name | chloro 2,2-dichloroacetate;hydride;rubidium(1+) |
| PubChem CID | 173369816 |
| Molecular Formula | C2H2Cl3O2Rb |
| Molecular Weight | 249.86 g/mol |
| Exact Mass | 247.82 |
| IUPAC Name | chloro 2,2-dichloroacetate;hydride;rubidium(1+) |
| SMILES | O=C(OCl)C(Cl)Cl.[H-].[Rb+] |
| InChI | InChI=1S/C2HCl3O2.Rb.H/c3-1(4)2(6)7-5;;/h1H;;/q;+1;-1 |
| InChIKey | OSHKXMSXUQMDOF-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.86 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloro 2,2-dichloroacetate;hydride;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro 2,2-dichloroacetate;hydride;rubidium(1+)?
The IUPAC name of chloro 2,2-dichloroacetate;hydride;rubidium(1+) (CID 173369816) is chloro 2,2-dichloroacetate;hydride;rubidium(1+).
What is the SMILES notation for chloro 2,2-dichloroacetate;hydride;rubidium(1+)?
The canonical SMILES for chloro 2,2-dichloroacetate;hydride;rubidium(1+) is O=C(OCl)C(Cl)Cl.[H-].[Rb+].
What is the InChIKey of chloro 2,2-dichloroacetate;hydride;rubidium(1+)?
The InChIKey is OSHKXMSXUQMDOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C2HCl3O2.Rb.H/c3-1(4)2(6)7-5;;/h1H;;/q;+1;-1.
What are the key properties of chloro 2,2-dichloroacetate;hydride;rubidium(1+)?
chloro 2,2-dichloroacetate;hydride;rubidium(1+) has a molecular weight of 249.86 g/mol, XLogP of -1.40, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloro 2,2-dichloroacetate;hydride;rubidium(1+) is sourced from PubChem (CID 173369816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).