C32H36N4O7S3 — CID 87200098
2-(1H-indol-5-yl)-5-[(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)oxy]-1,3,4-thiadiazole;bis(4-methylbenzenesulfonic acid) (PubChem CID 87200098) has the molecular formula C32H36N4O7S3 and a molecular weight of 684.86 g/mol. Its IUPAC name is 2-(1H-indol-5-yl)-5-[(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)oxy]-1,3,4-thiadiazole;bis(4-methylbenzenesulfonic acid).
| Compound Name | 2-(1H-indol-5-yl)-5-[(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)oxy]-1,3,4-thiadiazole;bis(4-methylbenzenesulfonic acid) |
|---|---|
| PubChem CID | 87200098 |
| Molecular Formula | C32H36N4O7S3 |
| Molecular Weight | 684.86 g/mol |
| Exact Mass | 684.17 |
| IUPAC Name | 2-(1H-indol-5-yl)-5-[(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)oxy]-1,3,4-thiadiazole;bis(4-methylbenzenesulfonic acid) |
| SMILES | CN1C2CCC1CC(Oc1nnc(-c3ccc4[nH]ccc4c3)s1)C2.Cc1ccc(S(=O)(=O)O)cc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C18H20N4OS.2C7H8O3S/c1-22-13-3-4-14(22)10-15(9-13)23-18-21-20-17(24-18)12-2-5-16-11(8-12)6-7-19-16;2*1-6-2-4-7(5-3-6)11(8,9)10/h2,5-8,13-15,19H,3-4,9-10H2,1H3;2*2-5H,1H3,(H,8,9,10) |
| InChIKey | SIYZAMWCXMIUDG-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 162.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.86 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|