C32H34N4O6S2 — CID 158751340
5-[5-[(1S,5S)-3,6-diazabicyclo[3.2.0]heptan-3-yl]-3-pyridinyl]-1H-indole;bis(4-methylbenzenesulfonic acid) (PubChem CID 158751340) has the molecular formula C32H34N4O6S2 and a molecular weight of 634.78 g/mol. Its IUPAC name is 5-[5-[(1S,5S)-3,6-diazabicyclo[3.2.0]heptan-3-yl]-3-pyridinyl]-1H-indole;bis(4-methylbenzenesulfonic acid).
| Compound Name | 5-[5-[(1S,5S)-3,6-diazabicyclo[3.2.0]heptan-3-yl]-3-pyridinyl]-1H-indole;bis(4-methylbenzenesulfonic acid) |
|---|---|
| PubChem CID | 158751340 |
| Molecular Formula | C32H34N4O6S2 |
| Molecular Weight | 634.78 g/mol |
| Exact Mass | 634.19 |
| IUPAC Name | 5-[5-[(1S,5S)-3,6-diazabicyclo[3.2.0]heptan-3-yl]-3-pyridinyl]-1H-indole;bis(4-methylbenzenesulfonic acid) |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.Cc1ccc(S(=O)(=O)O)cc1.c1cc2cc(-c3cncc(N4C[C@@H]5CN[C@@H]5C4)c3)ccc2[nH]1 |
| InChI | InChI=1S/C18H18N4.2C7H8O3S/c1-2-17-13(3-4-20-17)5-12(1)14-6-16(9-19-7-14)22-10-15-8-21-18(15)11-22;2*1-6-2-4-7(5-3-6)11(8,9)10/h1-7,9,15,18,20-21H,8,10-11H2;2*2-5H,1H3,(H,8,9,10)/t15-,18+;;/m0../s1 |
| InChIKey | INNDOFVRHKGZMU-AOTNPOKMSA-N |
| XLogP | 5.12 |
| TPSA | 152.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.78 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|