C25H28N4O5S — CID 56661136
4-methylbenzenesulfonic acid;2-methyl-5-[6-(3-nitrophenyl)-3-pyridinyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 56661136) has the molecular formula C25H28N4O5S and a molecular weight of 496.59 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;2-methyl-5-[6-(3-nitrophenyl)-3-pyridinyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 4-methylbenzenesulfonic acid;2-methyl-5-[6-(3-nitrophenyl)-3-pyridinyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 56661136 |
| Molecular Formula | C25H28N4O5S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 4-methylbenzenesulfonic acid;2-methyl-5-[6-(3-nitrophenyl)-3-pyridinyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CN1CC2CN(c3ccc(-c4cccc([N+](=O)[O-])c4)nc3)CC2C1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C18H20N4O2.C7H8O3S/c1-20-9-14-11-21(12-15(14)10-20)17-5-6-18(19-8-17)13-3-2-4-16(7-13)22(23)24;1-6-2-4-7(5-3-6)11(8,9)10/h2-8,14-15H,9-12H2,1H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | DITGEDFDOGHAER-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 116.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|