C46H47ClN8O6S2 — CID 87200479
1-[3-[4-[[7-[4-[(5-chloro-2-phenylphenyl)methyl]piperazin-1-yl]quinazolin-4-yl]sulfamoyl]-2-nitroanilino]-4-phenylsulfanylbutyl]pyrrolidine-2-carboxylic acid (PubChem CID 87200479) has the molecular formula C46H47ClN8O6S2 and a molecular weight of 907.52 g/mol. Its IUPAC name is 1-[3-[4-[[7-[4-[(5-chloro-2-phenylphenyl)methyl]piperazin-1-yl]quinazolin-4-yl]sulfamoyl]-2-nitroanilino]-4-phenylsulfanylbutyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[3-[4-[[7-[4-[(5-chloro-2-phenylphenyl)methyl]piperazin-1-yl]quinazolin-4-yl]sulfamoyl]-2-nitroanilino]-4-phenylsulfanylbutyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 87200479 |
| Molecular Formula | C46H47ClN8O6S2 |
| Molecular Weight | 907.52 g/mol |
| Exact Mass | 906.27 |
| IUPAC Name | 1-[3-[4-[[7-[4-[(5-chloro-2-phenylphenyl)methyl]piperazin-1-yl]quinazolin-4-yl]sulfamoyl]-2-nitroanilino]-4-phenylsulfanylbutyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCN1CCC(CSc1ccccc1)Nc1ccc(S(=O)(=O)Nc2ncnc3cc(N4CCN(Cc5cc(Cl)ccc5-c5ccccc5)CC4)ccc23)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C46H47ClN8O6S2/c47-34-13-16-39(32-8-3-1-4-9-32)33(26-34)29-52-22-24-53(25-23-52)36-14-17-40-42(27-36)48-31-49-45(40)51-63(60,61)38-15-18-41(44(28-38)55(58)59)50-35(30-62-37-10-5-2-6-11-37)19-21-54-20-7-12-43(54)46(56)57/h1-6,8-11,13-18,26-28,31,35,43,50H,7,12,19-25,29-30H2,(H,56,57)(H,48,49,51) |
| InChIKey | HQMUKTYRZUAXQF-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 174.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.52 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|