C25H26Cl2F4N4O3 — CID 87201026
6-[(1S,5R)-3-[[2-(2,5-dichloro-4-fluorophenoxy)-2-methylpropanoyl]amino]-8-azabicyclo[3.2.1]octan-8-yl]-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide (PubChem CID 87201026) has the molecular formula C25H26Cl2F4N4O3 and a molecular weight of 577.41 g/mol. Its IUPAC name is 6-[(1S,5R)-3-[[2-(2,5-dichloro-4-fluorophenoxy)-2-methylpropanoyl]amino]-8-azabicyclo[3.2.1]octan-8-yl]-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide.
| Compound Name | 6-[(1S,5R)-3-[[2-(2,5-dichloro-4-fluorophenoxy)-2-methylpropanoyl]amino]-8-azabicyclo[3.2.1]octan-8-yl]-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87201026 |
| Molecular Formula | C25H26Cl2F4N4O3 |
| Molecular Weight | 577.41 g/mol |
| Exact Mass | 576.13 |
| IUPAC Name | 6-[(1S,5R)-3-[[2-(2,5-dichloro-4-fluorophenoxy)-2-methylpropanoyl]amino]-8-azabicyclo[3.2.1]octan-8-yl]-N-(2,2,2-trifluoroethyl)pyridine-3-carboxamide |
| SMILES | CC(C)(Oc1cc(Cl)c(F)cc1Cl)C(=O)NC1C[C@H]2CC[C@@H](C1)N2c1ccc(C(=O)NCC(F)(F)F)cn1 |
| InChI | InChI=1S/C25H26Cl2F4N4O3/c1-24(2,38-20-10-17(26)19(28)9-18(20)27)23(37)34-14-7-15-4-5-16(8-14)35(15)21-6-3-13(11-32-21)22(36)33-12-25(29,30)31/h3,6,9-11,14-16H,4-5,7-8,12H2,1-2H3,(H,33,36)(H,34,37)/t14?,15-,16+ |
| InChIKey | OEEOSNBTBVWINZ-MQVJKMGUSA-N |
| XLogP | 5.29 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.41 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|