C26H28Cl2F4N4O3 — CID 87334039
6-[(1S,5R)-3-[[2-(2,4-dichloro-5-fluorophenoxy)-2-methylpropanoyl]amino]-8-azabicyclo[3.2.1]octan-8-yl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]pyridine-3-carboxamide (PubChem CID 87334039) has the molecular formula C26H28Cl2F4N4O3 and a molecular weight of 591.43 g/mol. Its IUPAC name is 6-[(1S,5R)-3-[[2-(2,4-dichloro-5-fluorophenoxy)-2-methylpropanoyl]amino]-8-azabicyclo[3.2.1]octan-8-yl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]pyridine-3-carboxamide.
| Compound Name | 6-[(1S,5R)-3-[[2-(2,4-dichloro-5-fluorophenoxy)-2-methylpropanoyl]amino]-8-azabicyclo[3.2.1]octan-8-yl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87334039 |
| Molecular Formula | C26H28Cl2F4N4O3 |
| Molecular Weight | 591.43 g/mol |
| Exact Mass | 590.15 |
| IUPAC Name | 6-[(1S,5R)-3-[[2-(2,4-dichloro-5-fluorophenoxy)-2-methylpropanoyl]amino]-8-azabicyclo[3.2.1]octan-8-yl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]pyridine-3-carboxamide |
| SMILES | C[C@H](NC(=O)c1ccc(N2[C@@H]3CC[C@H]2CC(NC(=O)C(C)(C)Oc2cc(F)c(Cl)cc2Cl)C3)nc1)C(F)(F)F |
| InChI | InChI=1S/C26H28Cl2F4N4O3/c1-13(26(30,31)32)34-23(37)14-4-7-22(33-12-14)36-16-5-6-17(36)9-15(8-16)35-24(38)25(2,3)39-21-11-20(29)18(27)10-19(21)28/h4,7,10-13,15-17H,5-6,8-9H2,1-3H3,(H,34,37)(H,35,38)/t13-,15?,16-,17+/m0/s1 |
| InChIKey | OYADBCCHFIARHG-LNRIEFBSSA-N |
| XLogP | 5.68 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.43 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|