C26H32FN3O5S — CID 87201767
[2-[[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]amino]-1,3-benzothiazol-6-yl] ethyl carbonate (PubChem CID 87201767) has the molecular formula C26H32FN3O5S and a molecular weight of 517.62 g/mol. Its IUPAC name is [2-[[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]amino]-1,3-benzothiazol-6-yl] ethyl carbonate.
| Compound Name | [2-[[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]amino]-1,3-benzothiazol-6-yl] ethyl carbonate |
|---|---|
| PubChem CID | 87201767 |
| Molecular Formula | C26H32FN3O5S |
| Molecular Weight | 517.62 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | [2-[[1-[(3,5-diethoxy-4-fluorophenyl)methyl]piperidin-4-yl]amino]-1,3-benzothiazol-6-yl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc2nc(NC3CCN(Cc4cc(OCC)c(F)c(OCC)c4)CC3)sc2c1 |
| InChI | InChI=1S/C26H32FN3O5S/c1-4-32-21-13-17(14-22(24(21)27)33-5-2)16-30-11-9-18(10-12-30)28-25-29-20-8-7-19(15-23(20)36-25)35-26(31)34-6-3/h7-8,13-15,18H,4-6,9-12,16H2,1-3H3,(H,28,29) |
| InChIKey | DPULBZOVLUTGGH-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 82.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.62 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|