C11H13NO4S — CID 87204195
N-[5-methylsulfonyl-2-(2-oxoethyl)phenyl]acetamide (PubChem CID 87204195) has the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. Its IUPAC name is N-[5-methylsulfonyl-2-(2-oxoethyl)phenyl]acetamide.
| Compound Name | N-[5-methylsulfonyl-2-(2-oxoethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 87204195 |
| Molecular Formula | C11H13NO4S |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | N-[5-methylsulfonyl-2-(2-oxoethyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(S(C)(=O)=O)ccc1CC=O |
| InChI | InChI=1S/C11H13NO4S/c1-8(14)12-11-7-10(17(2,15)16)4-3-9(11)5-6-13/h3-4,6-7H,5H2,1-2H3,(H,12,14) |
| InChIKey | QKCPTOHKYHFRDQ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|