C30H34F3N5O4S — CID 87205497
N-[1-cyclopentyl-1-[6-(2,2-difluoroethenyl)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-2-oxoethyl]-4-[5-fluoro-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide (PubChem CID 87205497) has the molecular formula C30H34F3N5O4S and a molecular weight of 617.69 g/mol. Its IUPAC name is N-[1-cyclopentyl-1-[6-(2,2-difluoroethenyl)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-2-oxoethyl]-4-[5-fluoro-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide.
| Compound Name | N-[1-cyclopentyl-1-[6-(2,2-difluoroethenyl)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-2-oxoethyl]-4-[5-fluoro-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide |
|---|---|
| PubChem CID | 87205497 |
| Molecular Formula | C30H34F3N5O4S |
| Molecular Weight | 617.69 g/mol |
| Exact Mass | 617.23 |
| IUPAC Name | N-[1-cyclopentyl-1-[6-(2,2-difluoroethenyl)-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-2-oxoethyl]-4-[5-fluoro-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide |
| SMILES | CN1CCN(c2nc(-c3ccc(C(=O)NC(C=O)(C4CCCC4)N4CC(C=C(F)F)C5OCC(=O)C54)cc3)c(F)s2)CC1 |
| InChI | InChI=1S/C30H34F3N5O4S/c1-36-10-12-37(13-11-36)29-34-24(27(33)43-29)18-6-8-19(9-7-18)28(41)35-30(17-39,21-4-2-3-5-21)38-15-20(14-23(31)32)26-25(38)22(40)16-42-26/h6-9,14,17,20-21,25-26H,2-5,10-13,15-16H2,1H3,(H,35,41) |
| InChIKey | IQLYAXBMSCAGBL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.69 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|