About 4-O-prop-2-enyl 1-O-tris(trimethylsilyl)silyl 2-methylidenebutanedioate
4-O-prop-2-enyl 1-O-tris(trimethylsilyl)silyl 2-methylidenebutanedioate (PubChem CID 87206657) has the molecular formula C17H36O4Si4
and a molecular weight of 416.82 g/mol. Its IUPAC name is 4-O-prop-2-enyl 1-O-tris(trimethylsilyl)silyl 2-methylidenebutanedioate.
Molecular Properties
| Compound Name | 4-O-prop-2-enyl 1-O-tris(trimethylsilyl)silyl 2-methylidenebutanedioate |
| PubChem CID | 87206657 |
| Molecular Formula | C17H36O4Si4 |
| Molecular Weight | 416.82 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 4-O-prop-2-enyl 1-O-tris(trimethylsilyl)silyl 2-methylidenebutanedioate |
| SMILES | C=CCOC(=O)CC(=C)C(=O)O[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C17H36O4Si4/c1-12-13-20-16(18)14-15(2)17(19)21-25(22(3,4)5,23(6,7)8)24(9,10)11/h12H,1-2,13-14H2,3-11H3 |
| InChIKey | NWKJQMHOCFFWRE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.82 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-O-prop-2-enyl 1-O-tris(trimethylsilyl)silyl 2-methylidenebutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-prop-2-enyl 1-O-tris(trimethylsilyl)silyl 2-methylidenebutanedioate?
The IUPAC name of 4-O-prop-2-enyl 1-O-tris(trimethylsilyl)silyl 2-methylidenebutanedioate (CID 87206657) is 4-O-prop-2-enyl 1-O-tris(trimethylsilyl)silyl 2-methylidenebutanedioate.
What is the SMILES notation for 4-O-prop-2-enyl 1-O-tris(trimethylsilyl)silyl 2-methylidenebutanedioate?
The canonical SMILES for 4-O-prop-2-enyl 1-O-tris(trimethylsilyl)silyl 2-methylidenebutanedioate is C=CCOC(=O)CC(=C)C(=O)O[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C.
What is the InChIKey of 4-O-prop-2-enyl 1-O-tris(trimethylsilyl)silyl 2-methylidenebutanedioate?
The InChIKey is NWKJQMHOCFFWRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36O4Si4/c1-12-13-20-16(18)14-15(2)17(19)21-25(22(3,4)5,23(6,7)8)24(9,10)11/h12H,1-2,13-14H2,3-11H3.
What are the key properties of 4-O-prop-2-enyl 1-O-tris(trimethylsilyl)silyl 2-methylidenebutanedioate?
4-O-prop-2-enyl 1-O-tris(trimethylsilyl)silyl 2-methylidenebutanedioate has a molecular weight of 416.82 g/mol, XLogP of 4.40, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-prop-2-enyl 1-O-tris(trimethylsilyl)silyl 2-methylidenebutanedioate is sourced from PubChem (CID 87206657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).