C29H28N2O4 — CID 87209031
(E)-3-(1'-benzyl-4-oxo-2'-phenylspiro[3H-chromene-2,4'-piperidine]-6-yl)-N-hydroxyprop-2-enamide (PubChem CID 87209031) has the molecular formula C29H28N2O4 and a molecular weight of 468.55 g/mol. Its IUPAC name is (E)-3-(1'-benzyl-4-oxo-2'-phenylspiro[3H-chromene-2,4'-piperidine]-6-yl)-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-(1'-benzyl-4-oxo-2'-phenylspiro[3H-chromene-2,4'-piperidine]-6-yl)-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 87209031 |
| Molecular Formula | C29H28N2O4 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | (E)-3-(1'-benzyl-4-oxo-2'-phenylspiro[3H-chromene-2,4'-piperidine]-6-yl)-N-hydroxyprop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)C(=O)CC1(CCN(Cc3ccccc3)C(c3ccccc3)C1)O2)NO |
| InChI | InChI=1S/C29H28N2O4/c32-26-19-29(35-27-13-11-21(17-24(26)27)12-14-28(33)30-34)15-16-31(20-22-7-3-1-4-8-22)25(18-29)23-9-5-2-6-10-23/h1-14,17,25,34H,15-16,18-20H2,(H,30,33)/b14-12+ |
| InChIKey | DYYZIQAMBPQJBJ-WYMLVPIESA-N |
| XLogP | 4.95 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|