C31H31N3O5 — CID 87208959
6-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-4-oxo-N-phenyl-1'-(2-phenylethyl)spiro[3H-chromene-2,4'-piperidine]-2'-carboxamide (PubChem CID 87208959) has the molecular formula C31H31N3O5 and a molecular weight of 525.61 g/mol. Its IUPAC name is 6-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-4-oxo-N-phenyl-1'-(2-phenylethyl)spiro[3H-chromene-2,4'-piperidine]-2'-carboxamide.
| Compound Name | 6-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-4-oxo-N-phenyl-1'-(2-phenylethyl)spiro[3H-chromene-2,4'-piperidine]-2'-carboxamide |
|---|---|
| PubChem CID | 87208959 |
| Molecular Formula | C31H31N3O5 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | 6-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-4-oxo-N-phenyl-1'-(2-phenylethyl)spiro[3H-chromene-2,4'-piperidine]-2'-carboxamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)C(=O)CC1(CCN(CCc3ccccc3)C(C(=O)Nc3ccccc3)C1)O2)NO |
| InChI | InChI=1S/C31H31N3O5/c35-27-21-31(39-28-13-11-23(19-25(27)28)12-14-29(36)33-38)16-18-34(17-15-22-7-3-1-4-8-22)26(20-31)30(37)32-24-9-5-2-6-10-24/h1-14,19,26,38H,15-18,20-21H2,(H,32,37)(H,33,36)/b14-12+ |
| InChIKey | VTLNAQLNTWGWBW-WYMLVPIESA-N |
| XLogP | 4.26 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|