C22H20N6O2 — CID 87209432
4-[[4-[(5-acetyl-7-methyl-2,3-dihydro-1H-inden-4-yl)oxyamino]-1,3,5-triazin-2-yl]amino]benzonitrile (PubChem CID 87209432) has the molecular formula C22H20N6O2 and a molecular weight of 400.44 g/mol. Its IUPAC name is 4-[[4-[(5-acetyl-7-methyl-2,3-dihydro-1H-inden-4-yl)oxyamino]-1,3,5-triazin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-[(5-acetyl-7-methyl-2,3-dihydro-1H-inden-4-yl)oxyamino]-1,3,5-triazin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 87209432 |
| Molecular Formula | C22H20N6O2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 4-[[4-[(5-acetyl-7-methyl-2,3-dihydro-1H-inden-4-yl)oxyamino]-1,3,5-triazin-2-yl]amino]benzonitrile |
| SMILES | CC(=O)c1cc(C)c2c(c1ONc1ncnc(Nc3ccc(C#N)cc3)n1)CCC2 |
| InChI | InChI=1S/C22H20N6O2/c1-13-10-19(14(2)29)20(18-5-3-4-17(13)18)30-28-22-25-12-24-21(27-22)26-16-8-6-15(11-23)7-9-16/h6-10,12H,3-5H2,1-2H3,(H2,24,25,26,27,28) |
| InChIKey | UUTTWXSCSAHWGE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|