C18H13N5O2 — CID 177497788
4-[[4-(2-acetylphenoxy)-1,3,5-triazin-2-yl]amino]benzonitrile (PubChem CID 177497788) has the molecular formula C18H13N5O2 and a molecular weight of 331.34 g/mol. Its IUPAC name is 4-[[4-(2-acetylphenoxy)-1,3,5-triazin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-(2-acetylphenoxy)-1,3,5-triazin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 177497788 |
| Molecular Formula | C18H13N5O2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 4-[[4-(2-acetylphenoxy)-1,3,5-triazin-2-yl]amino]benzonitrile |
| SMILES | CC(=O)c1ccccc1Oc1ncnc(Nc2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C18H13N5O2/c1-12(24)15-4-2-3-5-16(15)25-18-21-11-20-17(23-18)22-14-8-6-13(10-19)7-9-14/h2-9,11H,1H3,(H,20,21,22,23) |
| InChIKey | QZTNEGQOELESQT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |