C22H17N5O3 — CID 4767524
2-[(4,6-dianilino-1,3,5-triazin-2-yl)oxy]benzoic acid (PubChem CID 4767524) has the molecular formula C22H17N5O3 and a molecular weight of 399.41 g/mol. Its IUPAC name is 2-[(4,6-dianilino-1,3,5-triazin-2-yl)oxy]benzoic acid.
| Compound Name | 2-[(4,6-dianilino-1,3,5-triazin-2-yl)oxy]benzoic acid |
|---|---|
| PubChem CID | 4767524 |
| Molecular Formula | C22H17N5O3 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 2-[(4,6-dianilino-1,3,5-triazin-2-yl)oxy]benzoic acid |
| SMILES | O=C(O)c1ccccc1Oc1nc(Nc2ccccc2)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C22H17N5O3/c28-19(29)17-13-7-8-14-18(17)30-22-26-20(23-15-9-3-1-4-10-15)25-21(27-22)24-16-11-5-2-6-12-16/h1-14H,(H,28,29)(H2,23,24,25,26,27) |
| InChIKey | CBNVDDUTAHLEKP-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 109.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |